C42H49F3NO12P — CID 59205880
[6'-(2,2-dimethylpropanoyloxy)-6-[6-hydroxyhexoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate (PubChem CID 59205880) has the molecular formula C42H49F3NO12P and a molecular weight of 847.82 g/mol. Its IUPAC name is [6'-(2,2-dimethylpropanoyloxy)-6-[6-hydroxyhexoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate.
| Compound Name | [6'-(2,2-dimethylpropanoyloxy)-6-[6-hydroxyhexoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59205880 |
| Molecular Formula | C42H49F3NO12P |
| Molecular Weight | 847.82 g/mol |
| Exact Mass | 847.29 |
| IUPAC Name | [6'-(2,2-dimethylpropanoyloxy)-6-[6-hydroxyhexoxy-[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphoryl]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)Oc1cc(OC(=O)C(C)(C)C)ccc1C21OC(=O)c2ccc(P(=O)(OCCCCCCO)OCCCCNC(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C42H49F3NO12P/c1-39(2,3)37(50)55-26-13-17-30-33(23-26)57-34-24-27(56-38(51)40(4,5)6)14-18-31(34)41(30)32-25-28(15-16-29(32)35(48)58-41)59(52,53-21-11-8-7-10-20-47)54-22-12-9-19-46-36(49)42(43,44)45/h13-18,23-25,47H,7-12,19-22H2,1-6H3,(H,46,49) |
| InChIKey | VYOVLTLNDOCTTR-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.82 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|