C37H42N2O8S — CID 10056995
[6'-(2,2-dimethylpropanoyloxy)-5-(6-hydroxyhexylcarbamothioylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate (PubChem CID 10056995) has the molecular formula C37H42N2O8S and a molecular weight of 674.82 g/mol. Its IUPAC name is [6'-(2,2-dimethylpropanoyloxy)-5-(6-hydroxyhexylcarbamothioylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate.
| Compound Name | [6'-(2,2-dimethylpropanoyloxy)-5-(6-hydroxyhexylcarbamothioylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10056995 |
| Molecular Formula | C37H42N2O8S |
| Molecular Weight | 674.82 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | [6'-(2,2-dimethylpropanoyloxy)-5-(6-hydroxyhexylcarbamothioylamino)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)Oc1cc(OC(=O)C(C)(C)C)ccc1C21OC(=O)c2cc(NC(=S)NCCCCCCO)ccc21 |
| InChI | InChI=1S/C37H42N2O8S/c1-35(2,3)32(42)44-23-12-15-27-29(20-23)46-30-21-24(45-33(43)36(4,5)6)13-16-28(30)37(27)26-14-11-22(19-25(26)31(41)47-37)39-34(48)38-17-9-7-8-10-18-40/h11-16,19-21,40H,7-10,17-18H2,1-6H3,(H2,38,39,48) |
| InChIKey | FSGIOHRFZRPTMC-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.82 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|