C41H52N2O5S — CID 3037688
1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[9-(2-octylcyclopropyl)nonyl]thiourea (PubChem CID 3037688) has the molecular formula C41H52N2O5S and a molecular weight of 684.94 g/mol. Its IUPAC name is 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[9-(2-octylcyclopropyl)nonyl]thiourea.
| Compound Name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[9-(2-octylcyclopropyl)nonyl]thiourea |
|---|---|
| PubChem CID | 3037688 |
| Molecular Formula | C41H52N2O5S |
| Molecular Weight | 684.94 g/mol |
| Exact Mass | 684.36 |
| IUPAC Name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-[9-(2-octylcyclopropyl)nonyl]thiourea |
| SMILES | CCCCCCCCC1CC1CCCCCCCCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C41H52N2O5S/c1-2-3-4-5-9-12-15-28-24-29(28)16-13-10-7-6-8-11-14-23-42-40(49)43-30-17-20-34-33(25-30)39(46)48-41(34)35-21-18-31(44)26-37(35)47-38-27-32(45)19-22-36(38)41/h17-22,25-29,44-45H,2-16,23-24H2,1H3,(H2,42,43,49) |
| InChIKey | UGXIPZAFMPEWEE-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.94 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|