C29H22N2O5S — CID 11813225
1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-(3,5-dimethylphenyl)thiourea (PubChem CID 11813225) has the molecular formula C29H22N2O5S and a molecular weight of 510.57 g/mol. Its IUPAC name is 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 11813225 |
| Molecular Formula | C29H22N2O5S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)Nc2ccc3c(c2)C(=O)OC32c3ccc(O)cc3Oc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C29H22N2O5S/c1-15-9-16(2)11-18(10-15)31-28(37)30-17-3-6-22-21(12-17)27(34)36-29(22)23-7-4-19(32)13-25(23)35-26-14-20(33)5-8-24(26)29/h3-14,32-33H,1-2H3,(H2,30,31,37) |
| InChIKey | YDZGIJRUJVRGIP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|