C20H11IO5 — CID 12994513
3',6'-dihydroxy-6-iodospiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 12994513) has the molecular formula C20H11IO5 and a molecular weight of 458.21 g/mol. Its IUPAC name is 3',6'-dihydroxy-6-iodospiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-6-iodospiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 12994513 |
| Molecular Formula | C20H11IO5 |
| Molecular Weight | 458.21 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 3',6'-dihydroxy-6-iodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccc(I)cc21 |
| InChI | InChI=1S/C20H11IO5/c21-10-1-4-14-13(7-10)19(24)26-20(14)15-5-2-11(22)8-17(15)25-18-9-12(23)3-6-16(18)20/h1-9,22-23H |
| InChIKey | VLFPYWCZCNDOFX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.21 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|