C20H14NO8P — CID 174824643
[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]phosphonic acid (PubChem CID 174824643) has the molecular formula C20H14NO8P and a molecular weight of 427.31 g/mol. Its IUPAC name is [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]phosphonic acid.
| Compound Name | [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]phosphonic acid |
|---|---|
| PubChem CID | 174824643 |
| Molecular Formula | C20H14NO8P |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | [(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)amino]phosphonic acid |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccc(NP(=O)(O)O)cc21 |
| InChI | InChI=1S/C20H14NO8P/c22-11-2-5-15-17(8-11)28-18-9-12(23)3-6-16(18)20(15)14-4-1-10(21-30(25,26)27)7-13(14)19(24)29-20/h1-9,22-23H,(H3,21,25,26,27) |
| InChIKey | GEVGBQNIGKZVCB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|