C22H15IN2O6 — CID 174917065
N'-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetohydrazide (PubChem CID 174917065) has the molecular formula C22H15IN2O6 and a molecular weight of 530.27 g/mol. Its IUPAC name is N'-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetohydrazide.
| Compound Name | N'-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetohydrazide |
|---|---|
| PubChem CID | 174917065 |
| Molecular Formula | C22H15IN2O6 |
| Molecular Weight | 530.27 g/mol |
| Exact Mass | 530.00 |
| IUPAC Name | N'-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)-2-iodoacetohydrazide |
| SMILES | O=C(CI)NNc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H15IN2O6/c23-10-20(28)25-24-11-1-4-15-14(7-11)21(29)31-22(15)16-5-2-12(26)8-18(16)30-19-9-13(27)3-6-17(19)22/h1-9,24,26-27H,10H2,(H,25,28) |
| InChIKey | KUHIZWRQVWAIAV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|