C32H30INO8 — CID 122448957
[6'-(2,2-dimethylpropanoyloxy)-5-[(2-iodoacetyl)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate (PubChem CID 122448957) has the molecular formula C32H30INO8 and a molecular weight of 683.49 g/mol. Its IUPAC name is [6'-(2,2-dimethylpropanoyloxy)-5-[(2-iodoacetyl)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate.
| Compound Name | [6'-(2,2-dimethylpropanoyloxy)-5-[(2-iodoacetyl)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122448957 |
| Molecular Formula | C32H30INO8 |
| Molecular Weight | 683.49 g/mol |
| Exact Mass | 683.10 |
| IUPAC Name | [6'-(2,2-dimethylpropanoyloxy)-5-[(2-iodoacetyl)amino]-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc2c(c1)Oc1cc(OC(=O)C(C)(C)C)ccc1C21OC(=O)c2cc(NC(=O)CI)ccc21 |
| InChI | InChI=1S/C32H30INO8/c1-30(2,3)28(37)39-18-8-11-22-24(14-18)41-25-15-19(40-29(38)31(4,5)6)9-12-23(25)32(22)21-10-7-17(34-26(35)16-33)13-20(21)27(36)42-32/h7-15H,16H2,1-6H3,(H,34,35) |
| InChIKey | ZQKBITHZCBTGQY-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|