C26H18O9 — CID 91060599
2-(3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)acetic acid (PubChem CID 91060599) has the molecular formula C26H18O9 and a molecular weight of 474.42 g/mol. Its IUPAC name is 2-(3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)acetic acid.
| Compound Name | 2-(3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)acetic acid |
|---|---|
| PubChem CID | 91060599 |
| Molecular Formula | C26H18O9 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-(3',6'-diacetyloxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)acetic acid |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(OC(C)=O)ccc1C21OC(=O)c2cc(CC(=O)O)ccc21 |
| InChI | InChI=1S/C26H18O9/c1-13(27)32-16-4-7-20-22(11-16)34-23-12-17(33-14(2)28)5-8-21(23)26(20)19-6-3-15(10-24(29)30)9-18(19)25(31)35-26/h3-9,11-12H,10H2,1-2H3,(H,29,30) |
| InChIKey | XITYEQLSCDLZQI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|