C27H18O10 — CID 90792179
acetyl 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate (PubChem CID 90792179) has the molecular formula C27H18O10 and a molecular weight of 502.43 g/mol. Its IUPAC name is acetyl 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate.
| Compound Name | acetyl 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate |
|---|---|
| PubChem CID | 90792179 |
| Molecular Formula | C27H18O10 |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | acetyl 3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylate |
| SMILES | CC(=O)OC(=O)c1ccc2c(c1)C1(OC2=O)c2ccc(OC(C)=O)cc2Oc2cc(OC(C)=O)ccc21 |
| InChI | InChI=1S/C27H18O10/c1-13(28)33-17-5-8-20-23(11-17)36-24-12-18(34-14(2)29)6-9-21(24)27(20)22-10-16(25(31)35-15(3)30)4-7-19(22)26(32)37-27/h4-12H,1-3H3 |
| InChIKey | FQEPVLDEHDVCNY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|