C25H15N3O8 — CID 91188977
(6'-acetyloxy-5-carbonazidoyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (PubChem CID 91188977) has the molecular formula C25H15N3O8 and a molecular weight of 485.41 g/mol. Its IUPAC name is (6'-acetyloxy-5-carbonazidoyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate.
| Compound Name | (6'-acetyloxy-5-carbonazidoyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
|---|---|
| PubChem CID | 91188977 |
| Molecular Formula | C25H15N3O8 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | (6'-acetyloxy-5-carbonazidoyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(OC(C)=O)ccc1C21OC(=O)c2cc(C(=O)N=[N+]=[N-])ccc21 |
| InChI | InChI=1S/C25H15N3O8/c1-12(29)33-15-4-7-19-21(10-15)35-22-11-16(34-13(2)30)5-8-20(22)25(19)18-6-3-14(23(31)27-28-26)9-17(18)24(32)36-25/h3-11H,1-2H3 |
| InChIKey | NCUFQNDTBCDWJC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 153.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|