C25H20O8 — CID 101336735
[6'-(2,3-dihydroxypropoxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate (PubChem CID 101336735) has the molecular formula C25H20O8 and a molecular weight of 448.43 g/mol. Its IUPAC name is [6'-(2,3-dihydroxypropoxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate.
| Compound Name | [6'-(2,3-dihydroxypropoxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
|---|---|
| PubChem CID | 101336735 |
| Molecular Formula | C25H20O8 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [6'-(2,3-dihydroxypropoxy)-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)Oc1cc(OCC(O)CO)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C25H20O8/c1-14(27)31-17-7-9-21-23(11-17)32-22-10-16(30-13-15(28)12-26)6-8-20(22)25(21)19-5-3-2-4-18(19)24(29)33-25/h2-11,15,26,28H,12-13H2,1H3 |
| InChIKey | XVQKOKDJWTYSKQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|