C22H14O6 — CID 57227385
(4-deuterio-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (PubChem CID 57227385) has the molecular formula C22H14O6 and a molecular weight of 375.35 g/mol. Its IUPAC name is (4-deuterio-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate.
| Compound Name | (4-deuterio-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
|---|---|
| PubChem CID | 57227385 |
| Molecular Formula | C22H14O6 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (4-deuterio-6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| SMILES | [2H]c1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(OC(C)=O)ccc21 |
| InChI | InChI=1S/C22H14O6/c1-12(23)26-14-7-9-18-20(11-14)27-19-10-13(24)6-8-17(19)22(18)16-5-3-2-4-15(16)21(25)28-22/h2-11,24H,1H3/i4D |
| InChIKey | SIOSUSOSPIZPGV-QYKNYGDISA-N |
| XLogP | 3.89 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|