C21H14O5 — CID 18364099
3'-hydroxy-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 18364099) has the molecular formula C21H14O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 3'-hydroxy-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-hydroxy-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 18364099 |
| Molecular Formula | C21H14O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 3'-hydroxy-6'-methoxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | COc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C21H14O5/c1-24-13-7-9-17-19(11-13)25-18-10-12(22)6-8-16(18)21(17)15-5-3-2-4-14(15)20(23)26-21/h2-11,22H,1H3 |
| InChIKey | KDXNYSZNOWTPLE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |