C21H14O8P- — CID 42614803
(6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) hydrogen phosphate (PubChem CID 42614803) has the molecular formula C21H14O8P- and a molecular weight of 425.31 g/mol. Its IUPAC name is (6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) hydrogen phosphate.
| Compound Name | (6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) hydrogen phosphate |
|---|---|
| PubChem CID | 42614803 |
| Molecular Formula | C21H14O8P- |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | (6'-methoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) hydrogen phosphate |
| SMILES | COc1ccc2c(c1)Oc1cc(OP(=O)([O-])O)ccc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C21H15O8P/c1-26-12-6-8-16-18(10-12)27-19-11-13(29-30(23,24)25)7-9-17(19)21(16)15-5-3-2-4-14(15)20(22)28-21/h2-11H,1H3,(H2,23,24,25)/p-1 |
| InChIKey | QWBZNOKUBXSLRE-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|