C34H26N2O5 — CID 21242146
3',6'-bis(4-methoxyanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 21242146) has the molecular formula C34H26N2O5 and a molecular weight of 542.59 g/mol. Its IUPAC name is 3',6'-bis(4-methoxyanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis(4-methoxyanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 21242146 |
| Molecular Formula | C34H26N2O5 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 3',6'-bis(4-methoxyanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | COc1ccc(Nc2ccc3c(c2)Oc2cc(Nc4ccc(OC)cc4)ccc2C32OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H26N2O5/c1-38-25-13-7-21(8-14-25)35-23-11-17-29-31(19-23)40-32-20-24(36-22-9-15-26(39-2)16-10-22)12-18-30(32)34(29)28-6-4-3-5-27(28)33(37)41-34/h3-20,35-36H,1-2H3 |
| InChIKey | QWHFEIZTAFPNBR-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |