C40H40N4O3 — CID 11422222
3',6'-bis[4-(diethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 11422222) has the molecular formula C40H40N4O3 and a molecular weight of 624.78 g/mol. Its IUPAC name is 3',6'-bis[4-(diethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-bis[4-(diethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 11422222 |
| Molecular Formula | C40H40N4O3 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | 3',6'-bis[4-(diethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc(Nc2ccc3c(c2)Oc2cc(Nc4ccc(N(CC)CC)cc4)ccc2C32OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C40H40N4O3/c1-5-43(6-2)31-19-13-27(14-20-31)41-29-17-23-35-37(25-29)46-38-26-30(42-28-15-21-32(22-16-28)44(7-3)8-4)18-24-36(38)40(35)34-12-10-9-11-33(34)39(45)47-40/h9-26,41-42H,5-8H2,1-4H3 |
| InChIKey | SKYQHTPSZWFPDP-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|