C30H25IN2O3 — CID 140525779
2'-anilino-6'-(diethylamino)-3'-iodospiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 140525779) has the molecular formula C30H25IN2O3 and a molecular weight of 588.45 g/mol. Its IUPAC name is 2'-anilino-6'-(diethylamino)-3'-iodospiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-anilino-6'-(diethylamino)-3'-iodospiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 140525779 |
| Molecular Formula | C30H25IN2O3 |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | 2'-anilino-6'-(diethylamino)-3'-iodospiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(I)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C30H25IN2O3/c1-3-33(4-2)20-14-15-23-27(16-20)35-28-18-25(31)26(32-19-10-6-5-7-11-19)17-24(28)30(23)22-13-9-8-12-21(22)29(34)36-30/h5-18,32H,3-4H2,1-2H3 |
| InChIKey | XEBBVDVVSYWXTM-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|