C31H30N2O4 — CID 54071600
3-(5-anilino-2-hydroxy-4-methylphenyl)-3-[4-(diethylamino)-2-hydroxyphenyl]-2-benzofuran-1-one (PubChem CID 54071600) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is 3-(5-anilino-2-hydroxy-4-methylphenyl)-3-[4-(diethylamino)-2-hydroxyphenyl]-2-benzofuran-1-one.
| Compound Name | 3-(5-anilino-2-hydroxy-4-methylphenyl)-3-[4-(diethylamino)-2-hydroxyphenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 54071600 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 3-(5-anilino-2-hydroxy-4-methylphenyl)-3-[4-(diethylamino)-2-hydroxyphenyl]-2-benzofuran-1-one |
| SMILES | CCN(CC)c1ccc(C2(c3cc(Nc4ccccc4)c(C)cc3O)OC(=O)c3ccccc32)c(O)c1 |
| InChI | InChI=1S/C31H30N2O4/c1-4-33(5-2)22-15-16-25(29(35)18-22)31(24-14-10-9-13-23(24)30(36)37-31)26-19-27(20(3)17-28(26)34)32-21-11-7-6-8-12-21/h6-19,32,34-35H,4-5H2,1-3H3 |
| InChIKey | MGVJHRIZVJRXLN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|