C35H34N2O3 — CID 139647868
2'-anilino-3'-methyl-6'-[pentyl(prop-2-enyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139647868) has the molecular formula C35H34N2O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2'-anilino-3'-methyl-6'-[pentyl(prop-2-enyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-anilino-3'-methyl-6'-[pentyl(prop-2-enyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139647868 |
| Molecular Formula | C35H34N2O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2'-anilino-3'-methyl-6'-[pentyl(prop-2-enyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | C=CCN(CCCCC)c1ccc2c(c1)Oc1cc(C)c(Nc3ccccc3)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C35H34N2O3/c1-4-6-12-20-37(19-5-2)26-17-18-29-33(22-26)39-32-21-24(3)31(36-25-13-8-7-9-14-25)23-30(32)35(29)28-16-11-10-15-27(28)34(38)40-35/h5,7-11,13-18,21-23,36H,2,4,6,12,19-20H2,1,3H3 |
| InChIKey | FEAVDAUXODZNNJ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|