C41H48N2O3 — CID 139833517
6'-[ethyl(hexyl)amino]-3'-methyl-2'-(2,3,4-triethylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139833517) has the molecular formula C41H48N2O3 and a molecular weight of 616.85 g/mol. Its IUPAC name is 6'-[ethyl(hexyl)amino]-3'-methyl-2'-(2,3,4-triethylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 6'-[ethyl(hexyl)amino]-3'-methyl-2'-(2,3,4-triethylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139833517 |
| Molecular Formula | C41H48N2O3 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.37 |
| IUPAC Name | 6'-[ethyl(hexyl)amino]-3'-methyl-2'-(2,3,4-triethylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCCCN(CC)c1ccc2c(c1)Oc1cc(C)c(Nc3ccc(CC)c(CC)c3CC)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C41H48N2O3/c1-7-12-13-16-23-43(11-5)29-20-21-34-39(25-29)45-38-24-27(6)37(42-36-22-19-28(8-2)30(9-3)31(36)10-4)26-35(38)41(34)33-18-15-14-17-32(33)40(44)46-41/h14-15,17-22,24-26,42H,7-13,16,23H2,1-6H3 |
| InChIKey | YPIDFULQOHEMQC-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|