C31H34ClNO3 — CID 139647853
2'-chloro-6'-[ethyl(octyl)amino]-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139647853) has the molecular formula C31H34ClNO3 and a molecular weight of 504.07 g/mol. Its IUPAC name is 2'-chloro-6'-[ethyl(octyl)amino]-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-chloro-6'-[ethyl(octyl)amino]-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139647853 |
| Molecular Formula | C31H34ClNO3 |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2'-chloro-6'-[ethyl(octyl)amino]-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCCCCCN(CC)c1ccc2c(c1)Oc1cc(C)c(Cl)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C31H34ClNO3/c1-4-6-7-8-9-12-17-33(5-2)22-15-16-25-29(19-22)35-28-18-21(3)27(32)20-26(28)31(25)24-14-11-10-13-23(24)30(34)36-31/h10-11,13-16,18-20H,4-9,12,17H2,1-3H3 |
| InChIKey | VGOUODROKZMTLO-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|