C34H32Cl2N2O3 — CID 139647869
3'-chloro-2'-(2-chloroanilino)-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139647869) has the molecular formula C34H32Cl2N2O3 and a molecular weight of 587.55 g/mol. Its IUPAC name is 3'-chloro-2'-(2-chloroanilino)-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3'-chloro-2'-(2-chloroanilino)-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139647869 |
| Molecular Formula | C34H32Cl2N2O3 |
| Molecular Weight | 587.55 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 3'-chloro-2'-(2-chloroanilino)-6'-(dibutylamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCN(CCCC)c1ccc2c(c1)Oc1cc(Cl)c(Nc3ccccc3Cl)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C34H32Cl2N2O3/c1-3-5-17-38(18-6-4-2)22-15-16-25-31(19-22)40-32-21-28(36)30(37-29-14-10-9-13-27(29)35)20-26(32)34(25)24-12-8-7-11-23(24)33(39)41-34/h7-16,19-21,37H,3-6,17-18H2,1-2H3 |
| InChIKey | QPJQJGPOOLZHCI-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.55 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |