C35H35ClN2O3 — CID 14323737
2'-chloro-6'-[4-(dibutylamino)anilino]-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 14323737) has the molecular formula C35H35ClN2O3 and a molecular weight of 567.13 g/mol. Its IUPAC name is 2'-chloro-6'-[4-(dibutylamino)anilino]-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-chloro-6'-[4-(dibutylamino)anilino]-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 14323737 |
| Molecular Formula | C35H35ClN2O3 |
| Molecular Weight | 567.13 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2'-chloro-6'-[4-(dibutylamino)anilino]-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCN(CCCC)c1ccc(Nc2ccc3c(c2)Oc2cc(C)c(Cl)cc2C32OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C35H35ClN2O3/c1-4-6-18-38(19-7-5-2)26-15-12-24(13-16-26)37-25-14-17-29-33(21-25)40-32-20-23(3)31(36)22-30(32)35(29)28-11-9-8-10-27(28)34(39)41-35/h8-17,20-22,37H,4-7,18-19H2,1-3H3 |
| InChIKey | JQDJAPLGXJLBGN-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.13 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|