About 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one
6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 14496086) has the molecular formula C30H26N2O3
and a molecular weight of 462.55 g/mol. Its IUPAC name is 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 14496086 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | Cc1cc2c(cc1C)C1(OC(=O)c3ccccc31)c1ccc(Nc3ccc(N(C)C)cc3)cc1O2 |
| InChI | InChI=1S/C30H26N2O3/c1-18-15-26-27(16-19(18)2)34-28-17-21(31-20-9-12-22(13-10-20)32(3)4)11-14-25(28)30(26)24-8-6-5-7-23(24)29(33)35-30/h5-17,31H,1-4H3 |
| InChIKey | MSUUSUPZTANNKK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (CID 14496086) is 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one is Cc1cc2c(cc1C)C1(OC(=O)c3ccccc31)c1ccc(Nc3ccc(N(C)C)cc3)cc1O2.
What is the InChIKey of 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is MSUUSUPZTANNKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26N2O3/c1-18-15-26-27(16-19(18)2)34-28-17-21(31-20-9-12-22(13-10-20)32(3)4)11-14-25(28)30(26)24-8-6-5-7-23(24)29(33)35-30/h5-17,31H,1-4H3.
What are the key properties of 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one?
6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 462.55 g/mol, XLogP of 6.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-[4-(dimethylamino)anilino]-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 14496086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).