C34H34N2O3 — CID 139706053
6'-[4-(dimethylamino)anilino]-1',2',4'-triethylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139706053) has the molecular formula C34H34N2O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is 6'-[4-(dimethylamino)anilino]-1',2',4'-triethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 6'-[4-(dimethylamino)anilino]-1',2',4'-triethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139706053 |
| Molecular Formula | C34H34N2O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 6'-[4-(dimethylamino)anilino]-1',2',4'-triethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCc1cc(CC)c2c(c1CC)C1(OC(=O)c3ccccc31)c1ccc(Nc3ccc(N(C)C)cc3)cc1O2 |
| InChI | InChI=1S/C34H34N2O3/c1-6-21-19-22(7-2)32-31(26(21)8-3)34(28-12-10-9-11-27(28)33(37)39-34)29-18-15-24(20-30(29)38-32)35-23-13-16-25(17-14-23)36(4)5/h9-20,35H,6-8H2,1-5H3 |
| InChIKey | RTEMIBGSACNNLL-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|