C34H29N3O2 — CID 154100598
3,3-bis(4-anilinophenyl)-6-(dimethylamino)-2-benzofuran-1-one (PubChem CID 154100598) has the molecular formula C34H29N3O2 and a molecular weight of 511.63 g/mol. Its IUPAC name is 3,3-bis(4-anilinophenyl)-6-(dimethylamino)-2-benzofuran-1-one.
| Compound Name | 3,3-bis(4-anilinophenyl)-6-(dimethylamino)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 154100598 |
| Molecular Formula | C34H29N3O2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 3,3-bis(4-anilinophenyl)-6-(dimethylamino)-2-benzofuran-1-one |
| SMILES | CN(C)c1ccc2c(c1)C(=O)OC2(c1ccc(Nc2ccccc2)cc1)c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C34H29N3O2/c1-37(2)30-21-22-32-31(23-30)33(38)39-34(32,24-13-17-28(18-14-24)35-26-9-5-3-6-10-26)25-15-19-29(20-16-25)36-27-11-7-4-8-12-27/h3-23,35-36H,1-2H3 |
| InChIKey | DSFSZBVCASUVQI-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |