C30H24Cl2N2O3 — CID 14496089
2',4'-dichloro-6'-[4-(diethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 14496089) has the molecular formula C30H24Cl2N2O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is 2',4'-dichloro-6'-[4-(diethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2',4'-dichloro-6'-[4-(diethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 14496089 |
| Molecular Formula | C30H24Cl2N2O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 2',4'-dichloro-6'-[4-(diethylamino)anilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCN(CC)c1ccc(Nc2ccc3c(c2)Oc2c(Cl)cc(Cl)cc2C32OC(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H24Cl2N2O3/c1-3-34(4-2)21-12-9-19(10-13-21)33-20-11-14-24-27(17-20)36-28-25(15-18(31)16-26(28)32)30(24)23-8-6-5-7-22(23)29(35)37-30/h5-17,33H,3-4H2,1-2H3 |
| InChIKey | HRLMKTJRWCBOPQ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|