About 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one
6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 23104127) has the molecular formula C30H24ClNO3
and a molecular weight of 481.98 g/mol. Its IUPAC name is 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 23104127 |
| Molecular Formula | C30H24ClNO3 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCN(c1ccc(Cl)cc1)c1ccc2c(c1)Oc1cc(C)c(C)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C30H24ClNO3/c1-4-32(21-11-9-20(31)10-12-21)22-13-14-25-28(17-22)34-27-16-19(3)18(2)15-26(27)30(25)24-8-6-5-7-23(24)29(33)35-30/h5-17H,4H2,1-3H3 |
| InChIKey | DXWRFYQZGZAPBH-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (CID 23104127) is 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one is CCN(c1ccc(Cl)cc1)c1ccc2c(c1)Oc1cc(C)c(C)cc1C21OC(=O)c2ccccc21.
What is the InChIKey of 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is DXWRFYQZGZAPBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24ClNO3/c1-4-32(21-11-9-20(31)10-12-21)22-13-14-25-28(17-22)34-27-16-19(3)18(2)15-26(27)30(25)24-8-6-5-7-23(24)29(33)35-30/h5-17H,4H2,1-3H3.
What are the key properties of 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one?
6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 481.98 g/mol, XLogP of 7.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-(4-chloro-N-ethylanilino)-2',3'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 23104127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).