C33H32N2O3 — CID 139704929
6'-(diethylamino)-2'-(N-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139704929) has the molecular formula C33H32N2O3 and a molecular weight of 504.63 g/mol. Its IUPAC name is 6'-(diethylamino)-2'-(N-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 6'-(diethylamino)-2'-(N-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139704929 |
| Molecular Formula | C33H32N2O3 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 6'-(diethylamino)-2'-(N-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCN(c1ccccc1)c1ccc2c(c1)C1(OC(=O)c3ccccc31)c1ccc(N(CC)CC)cc1O2 |
| InChI | InChI=1S/C33H32N2O3/c1-4-20-35(23-12-8-7-9-13-23)25-17-19-30-29(21-25)33(27-15-11-10-14-26(27)32(36)38-33)28-18-16-24(22-31(28)37-30)34(5-2)6-3/h7-19,21-22H,4-6,20H2,1-3H3 |
| InChIKey | MECWIDIQVAASFT-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |