About 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one
2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 14177672) has the molecular formula C24H20ClNO3
and a molecular weight of 405.88 g/mol. Its IUPAC name is 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 14177672 |
| Molecular Formula | C24H20ClNO3 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCN(C)c1ccc2c(c1)Oc1ccc(Cl)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H20ClNO3/c1-3-12-26(2)16-9-10-19-22(14-16)28-21-11-8-15(25)13-20(21)24(19)18-7-5-4-6-17(18)23(27)29-24/h4-11,13-14H,3,12H2,1-2H3 |
| InChIKey | RJEUDRXPENPFFJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one (CID 14177672) is 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one is CCCN(C)c1ccc2c(c1)Oc1ccc(Cl)cc1C21OC(=O)c2ccccc21.
What is the InChIKey of 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is RJEUDRXPENPFFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20ClNO3/c1-3-12-26(2)16-9-10-19-22(14-16)28-21-11-8-15(25)13-20(21)24(19)18-7-5-4-6-17(18)23(27)29-24/h4-11,13-14H,3,12H2,1-2H3.
What are the key properties of 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one?
2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 405.88 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-chloro-6'-[methyl(propyl)amino]spiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 14177672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).