C36H30N2O3 — CID 58861685
6'-(N-methylanilino)-2'-(N-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 58861685) has the molecular formula C36H30N2O3 and a molecular weight of 538.65 g/mol. Its IUPAC name is 6'-(N-methylanilino)-2'-(N-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 6'-(N-methylanilino)-2'-(N-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 58861685 |
| Molecular Formula | C36H30N2O3 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | 6'-(N-methylanilino)-2'-(N-propylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCN(c1ccccc1)c1ccc2c(c1)C1(OC(=O)c3ccccc31)c1ccc(N(C)c3ccccc3)cc1O2 |
| InChI | InChI=1S/C36H30N2O3/c1-3-22-38(26-14-8-5-9-15-26)28-19-21-33-32(23-28)36(30-17-11-10-16-29(30)35(39)41-36)31-20-18-27(24-34(31)40-33)37(2)25-12-6-4-7-13-25/h4-21,23-24H,3,22H2,1-2H3 |
| InChIKey | VJVCWHUINWXHFQ-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |