C30H25NO3 — CID 143856827
2'-(N-ethyl-2,4-dimethylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 143856827) has the molecular formula C30H25NO3 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2'-(N-ethyl-2,4-dimethylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-(N-ethyl-2,4-dimethylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 143856827 |
| Molecular Formula | C30H25NO3 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 2'-(N-ethyl-2,4-dimethylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCN(c1ccc2c(c1)C1(OC(=O)c3ccccc31)c1ccccc1O2)c1ccc(C)cc1C |
| InChI | InChI=1S/C30H25NO3/c1-4-31(26-15-13-19(2)17-20(26)3)21-14-16-28-25(18-21)30(24-11-7-8-12-27(24)33-28)23-10-6-5-9-22(23)29(32)34-30/h5-18H,4H2,1-3H3 |
| InChIKey | XYLSKZFCDLPLRW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |