C40H37ClN2O3 — CID 155703223
2'-(4-chloroanilino)-6'-(N-hexyl-4-methylanilino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 155703223) has the molecular formula C40H37ClN2O3 and a molecular weight of 629.20 g/mol. Its IUPAC name is 2'-(4-chloroanilino)-6'-(N-hexyl-4-methylanilino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-(4-chloroanilino)-6'-(N-hexyl-4-methylanilino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 155703223 |
| Molecular Formula | C40H37ClN2O3 |
| Molecular Weight | 629.20 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | 2'-(4-chloroanilino)-6'-(N-hexyl-4-methylanilino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCCCN(c1ccc(C)cc1)c1ccc2c(c1)Oc1cc(C)c(Nc3ccc(Cl)cc3)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C40H37ClN2O3/c1-4-5-6-9-22-43(30-18-12-26(2)13-19-30)31-20-21-34-38(24-31)45-37-23-27(3)36(42-29-16-14-28(41)15-17-29)25-35(37)40(34)33-11-8-7-10-32(33)39(44)46-40/h7-8,10-21,23-25,42H,4-6,9,22H2,1-3H3 |
| InChIKey | XAUXCFSTCZQFJZ-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.20 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|