C38H42N2O3 — CID 139789397
6'-(dipentylamino)-3'-methyl-2'-(3-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139789397) has the molecular formula C38H42N2O3 and a molecular weight of 574.77 g/mol. Its IUPAC name is 6'-(dipentylamino)-3'-methyl-2'-(3-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 6'-(dipentylamino)-3'-methyl-2'-(3-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139789397 |
| Molecular Formula | C38H42N2O3 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 6'-(dipentylamino)-3'-methyl-2'-(3-methylanilino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCCN(CCCCC)c1ccc2c(c1)Oc1cc(C)c(Nc3cccc(C)c3)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C38H42N2O3/c1-5-7-11-20-40(21-12-8-6-2)29-18-19-32-36(24-29)42-35-23-27(4)34(39-28-15-13-14-26(3)22-28)25-33(35)38(32)31-17-10-9-16-30(31)37(41)43-38/h9-10,13-19,22-25,39H,5-8,11-12,20-21H2,1-4H3 |
| InChIKey | YCPXAFPVXMXALG-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|