C36H38N2O3 — CID 139725934
2'-anilino-6'-(dibutylamino)-3',7'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 139725934) has the molecular formula C36H38N2O3 and a molecular weight of 546.71 g/mol. Its IUPAC name is 2'-anilino-6'-(dibutylamino)-3',7'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-anilino-6'-(dibutylamino)-3',7'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 139725934 |
| Molecular Formula | C36H38N2O3 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 2'-anilino-6'-(dibutylamino)-3',7'-dimethylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCN(CCCC)c1cc2c(cc1C)C1(OC(=O)c3ccccc31)c1cc(Nc3ccccc3)c(C)cc1O2 |
| InChI | InChI=1S/C36H38N2O3/c1-5-7-18-38(19-8-6-2)32-23-34-29(20-25(32)4)36(28-17-13-12-16-27(28)35(39)41-36)30-22-31(24(3)21-33(30)40-34)37-26-14-10-9-11-15-26/h9-17,20-23,37H,5-8,18-19H2,1-4H3 |
| InChIKey | HTMOTVFBFYGOHK-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |