C37H39ClN2O3 — CID 140880562
2'-[4-chloro-5-(dipentylamino)-2-methylanilino]spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 140880562) has the molecular formula C37H39ClN2O3 and a molecular weight of 595.18 g/mol. Its IUPAC name is 2'-[4-chloro-5-(dipentylamino)-2-methylanilino]spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 2'-[4-chloro-5-(dipentylamino)-2-methylanilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 140880562 |
| Molecular Formula | C37H39ClN2O3 |
| Molecular Weight | 595.18 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | 2'-[4-chloro-5-(dipentylamino)-2-methylanilino]spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCCN(CCCCC)c1cc(Nc2ccc3c(c2)C2(OC(=O)c4ccccc42)c2ccccc2O3)c(C)cc1Cl |
| InChI | InChI=1S/C37H39ClN2O3/c1-4-6-12-20-40(21-13-7-5-2)33-24-32(25(3)22-31(33)38)39-26-18-19-35-30(23-26)37(29-16-10-11-17-34(29)42-35)28-15-9-8-14-27(28)36(41)43-37/h8-11,14-19,22-24,39H,4-7,12-13,20-21H2,1-3H3 |
| InChIKey | GWKAROPQQYMGQA-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.18 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|