C41H38BrClN2O3 — CID 155703234
6'-(3-bromo-N-octylanilino)-2'-(2-chloroanilino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 155703234) has the molecular formula C41H38BrClN2O3 and a molecular weight of 722.12 g/mol. Its IUPAC name is 6'-(3-bromo-N-octylanilino)-2'-(2-chloroanilino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 6'-(3-bromo-N-octylanilino)-2'-(2-chloroanilino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 155703234 |
| Molecular Formula | C41H38BrClN2O3 |
| Molecular Weight | 722.12 g/mol |
| Exact Mass | 720.18 |
| IUPAC Name | 6'-(3-bromo-N-octylanilino)-2'-(2-chloroanilino)-3'-methylspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CCCCCCCCN(c1cccc(Br)c1)c1ccc2c(c1)Oc1cc(C)c(Nc3ccccc3Cl)cc1C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C41H38BrClN2O3/c1-3-4-5-6-7-12-22-45(29-15-13-14-28(42)24-29)30-20-21-33-39(25-30)47-38-23-27(2)37(44-36-19-11-10-18-35(36)43)26-34(38)41(33)32-17-9-8-16-31(32)40(46)48-41/h8-11,13-21,23-26,44H,3-7,12,22H2,1-2H3 |
| InChIKey | MVLLRURKHBKCLQ-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.12 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|