C68H88N4O4 — CID 157114567
3,3-bis[4-(dibutylamino)-2-methylphenyl]-2-benzofuran-1-one;3,3-bis[4-(diethylamino)-2-methylphenyl]-2-benzofuran-1-one (PubChem CID 157114567) has the molecular formula C68H88N4O4 and a molecular weight of 1025.48 g/mol. Its IUPAC name is 3,3-bis[4-(dibutylamino)-2-methylphenyl]-2-benzofuran-1-one;3,3-bis[4-(diethylamino)-2-methylphenyl]-2-benzofuran-1-one.
| Compound Name | 3,3-bis[4-(dibutylamino)-2-methylphenyl]-2-benzofuran-1-one;3,3-bis[4-(diethylamino)-2-methylphenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 157114567 |
| Molecular Formula | C68H88N4O4 |
| Molecular Weight | 1025.48 g/mol |
| Exact Mass | 1024.68 |
| IUPAC Name | 3,3-bis[4-(dibutylamino)-2-methylphenyl]-2-benzofuran-1-one;3,3-bis[4-(diethylamino)-2-methylphenyl]-2-benzofuran-1-one |
| SMILES | CCCCN(CCCC)c1ccc(C2(c3ccc(N(CCCC)CCCC)cc3C)OC(=O)c3ccccc32)c(C)c1.CCN(CC)c1ccc(C2(c3ccc(N(CC)CC)cc3C)OC(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C38H52N2O2.C30H36N2O2/c1-7-11-23-39(24-12-8-2)31-19-21-34(29(5)27-31)38(36-18-16-15-17-33(36)37(41)42-38)35-22-20-32(28-30(35)6)40(25-13-9-3)26-14-10-4;1-7-31(8-2)23-15-17-26(21(5)19-23)30(28-14-12-11-13-25(28)29(33)34-30)27-18-16-24(20-22(27)6)32(9-3)10-4/h15-22,27-28H,7-14,23-26H2,1-6H3;11-20H,7-10H2,1-6H3 |
| InChIKey | AHFYMFAATAXUBH-UHFFFAOYSA-N |
| XLogP | 16.04 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.48 |
| LogP ≤ 5 | 16.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|