C37H51N3O2 — CID 139790074
7,7-bis[4-(dibutylamino)-2-methylphenyl]furo[3,4-b]pyridin-5-one (PubChem CID 139790074) has the molecular formula C37H51N3O2 and a molecular weight of 569.83 g/mol. Its IUPAC name is 7,7-bis[4-(dibutylamino)-2-methylphenyl]furo[3,4-b]pyridin-5-one.
| Compound Name | 7,7-bis[4-(dibutylamino)-2-methylphenyl]furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139790074 |
| Molecular Formula | C37H51N3O2 |
| Molecular Weight | 569.83 g/mol |
| Exact Mass | 569.40 |
| IUPAC Name | 7,7-bis[4-(dibutylamino)-2-methylphenyl]furo[3,4-b]pyridin-5-one |
| SMILES | CCCCN(CCCC)c1ccc(C2(c3ccc(N(CCCC)CCCC)cc3C)OC(=O)c3cccnc32)c(C)c1 |
| InChI | InChI=1S/C37H51N3O2/c1-7-11-22-39(23-12-8-2)30-17-19-33(28(5)26-30)37(35-32(36(41)42-37)16-15-21-38-35)34-20-18-31(27-29(34)6)40(24-13-9-3)25-14-10-4/h15-21,26-27H,7-14,22-25H2,1-6H3 |
| InChIKey | HZJGLNJJVARWMH-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.83 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|