C35H47N3O4 — CID 139834048
7,7-bis[4-(dipropylamino)-2-ethoxyphenyl]furo[3,4-b]pyridin-5-one (PubChem CID 139834048) has the molecular formula C35H47N3O4 and a molecular weight of 573.78 g/mol. Its IUPAC name is 7,7-bis[4-(dipropylamino)-2-ethoxyphenyl]furo[3,4-b]pyridin-5-one.
| Compound Name | 7,7-bis[4-(dipropylamino)-2-ethoxyphenyl]furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139834048 |
| Molecular Formula | C35H47N3O4 |
| Molecular Weight | 573.78 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | 7,7-bis[4-(dipropylamino)-2-ethoxyphenyl]furo[3,4-b]pyridin-5-one |
| SMILES | CCCN(CCC)c1ccc(C2(c3ccc(N(CCC)CCC)cc3OCC)OC(=O)c3cccnc32)c(OCC)c1 |
| InChI | InChI=1S/C35H47N3O4/c1-7-20-37(21-8-2)26-15-17-29(31(24-26)40-11-5)35(33-28(34(39)42-35)14-13-19-36-33)30-18-16-27(25-32(30)41-12-6)38(22-9-3)23-10-4/h13-19,24-25H,7-12,20-23H2,1-6H3 |
| InChIKey | CXJSVDCAYRAALA-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 64.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.78 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|