C29H34ClN3O3 — CID 139669640
3-[2-chloro-4-(diethylamino)phenyl]-3-[4-(diethylamino)-2-ethoxyphenyl]furo[3,4-c]pyridin-1-one (PubChem CID 139669640) has the molecular formula C29H34ClN3O3 and a molecular weight of 508.06 g/mol. Its IUPAC name is 3-[2-chloro-4-(diethylamino)phenyl]-3-[4-(diethylamino)-2-ethoxyphenyl]furo[3,4-c]pyridin-1-one.
| Compound Name | 3-[2-chloro-4-(diethylamino)phenyl]-3-[4-(diethylamino)-2-ethoxyphenyl]furo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 139669640 |
| Molecular Formula | C29H34ClN3O3 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 3-[2-chloro-4-(diethylamino)phenyl]-3-[4-(diethylamino)-2-ethoxyphenyl]furo[3,4-c]pyridin-1-one |
| SMILES | CCOc1cc(N(CC)CC)ccc1C1(c2ccc(N(CC)CC)cc2Cl)OC(=O)c2ccncc21 |
| InChI | InChI=1S/C29H34ClN3O3/c1-6-32(7-2)20-11-13-23(26(30)17-20)29(25-19-31-16-15-22(25)28(34)36-29)24-14-12-21(33(8-3)9-4)18-27(24)35-10-5/h11-19H,6-10H2,1-5H3 |
| InChIKey | CXFZSMGEMGDJQD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|