C29H33Cl2N3O2 — CID 139642810
1,1-bis[2-(chloromethyl)-4-(diethylamino)phenyl]furo[3,4-c]pyridin-3-one (PubChem CID 139642810) has the molecular formula C29H33Cl2N3O2 and a molecular weight of 526.51 g/mol. Its IUPAC name is 1,1-bis[2-(chloromethyl)-4-(diethylamino)phenyl]furo[3,4-c]pyridin-3-one.
| Compound Name | 1,1-bis[2-(chloromethyl)-4-(diethylamino)phenyl]furo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 139642810 |
| Molecular Formula | C29H33Cl2N3O2 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 1,1-bis[2-(chloromethyl)-4-(diethylamino)phenyl]furo[3,4-c]pyridin-3-one |
| SMILES | CCN(CC)c1ccc(C2(c3ccc(N(CC)CC)cc3CCl)OC(=O)c3cnccc32)c(CCl)c1 |
| InChI | InChI=1S/C29H33Cl2N3O2/c1-5-33(6-2)22-9-11-25(20(15-22)17-30)29(27-13-14-32-19-24(27)28(35)36-29)26-12-10-23(16-21(26)18-31)34(7-3)8-4/h9-16,19H,5-8,17-18H2,1-4H3 |
| InChIKey | MIIAKNQEPYHJOG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|