C25H25Cl2N3O2 — CID 139642796
5,5-bis[2-(chloromethyl)-4-(dimethylamino)phenyl]furo[3,4-b]pyridin-7-one (PubChem CID 139642796) has the molecular formula C25H25Cl2N3O2 and a molecular weight of 470.40 g/mol. Its IUPAC name is 5,5-bis[2-(chloromethyl)-4-(dimethylamino)phenyl]furo[3,4-b]pyridin-7-one.
| Compound Name | 5,5-bis[2-(chloromethyl)-4-(dimethylamino)phenyl]furo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 139642796 |
| Molecular Formula | C25H25Cl2N3O2 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 5,5-bis[2-(chloromethyl)-4-(dimethylamino)phenyl]furo[3,4-b]pyridin-7-one |
| SMILES | CN(C)c1ccc(C2(c3ccc(N(C)C)cc3CCl)OC(=O)c3ncccc32)c(CCl)c1 |
| InChI | InChI=1S/C25H25Cl2N3O2/c1-29(2)18-7-9-20(16(12-18)14-26)25(22-6-5-11-28-23(22)24(31)32-25)21-10-8-19(30(3)4)13-17(21)15-27/h5-13H,14-15H2,1-4H3 |
| InChIKey | UHURXWCNZJRKQD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|