C27H23N3O2 — CID 139669511
5,5-bis(1-ethylindol-3-yl)furo[3,4-b]pyridin-7-one (PubChem CID 139669511) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 5,5-bis(1-ethylindol-3-yl)furo[3,4-b]pyridin-7-one.
| Compound Name | 5,5-bis(1-ethylindol-3-yl)furo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 139669511 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 5,5-bis(1-ethylindol-3-yl)furo[3,4-b]pyridin-7-one |
| SMILES | CCn1cc(C2(c3cn(CC)c4ccccc34)OC(=O)c3ncccc32)c2ccccc21 |
| InChI | InChI=1S/C27H23N3O2/c1-3-29-16-21(18-10-5-7-13-23(18)29)27(20-12-9-15-28-25(20)26(31)32-27)22-17-30(4-2)24-14-8-6-11-19(22)24/h5-17H,3-4H2,1-2H3 |
| InChIKey | PBNWQIHUKCTGPV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |