C33H39N3O3 — CID 14177724
5-[4-(diethylamino)-2-pentoxyphenyl]-5-(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-7-one (PubChem CID 14177724) has the molecular formula C33H39N3O3 and a molecular weight of 525.69 g/mol. Its IUPAC name is 5-[4-(diethylamino)-2-pentoxyphenyl]-5-(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-7-one.
| Compound Name | 5-[4-(diethylamino)-2-pentoxyphenyl]-5-(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 14177724 |
| Molecular Formula | C33H39N3O3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 5-[4-(diethylamino)-2-pentoxyphenyl]-5-(1-ethyl-2-methylindol-3-yl)furo[3,4-b]pyridin-7-one |
| SMILES | CCCCCOc1cc(N(CC)CC)ccc1C1(c2c(C)n(CC)c3ccccc23)OC(=O)c2ncccc21 |
| InChI | InChI=1S/C33H39N3O3/c1-6-10-13-21-38-29-22-24(35(7-2)8-3)18-19-26(29)33(27-16-14-20-34-31(27)32(37)39-33)30-23(5)36(9-4)28-17-12-11-15-25(28)30/h11-12,14-20,22H,6-10,13,21H2,1-5H3 |
| InChIKey | TYBVYNUGALBIIJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|