C35H43N3O3 — CID 139669632
3-[2-butoxy-4-(diethylamino)phenyl]-3-(2-methyl-1-pentylindol-3-yl)furo[3,4-c]pyridin-1-one (PubChem CID 139669632) has the molecular formula C35H43N3O3 and a molecular weight of 553.75 g/mol. Its IUPAC name is 3-[2-butoxy-4-(diethylamino)phenyl]-3-(2-methyl-1-pentylindol-3-yl)furo[3,4-c]pyridin-1-one.
| Compound Name | 3-[2-butoxy-4-(diethylamino)phenyl]-3-(2-methyl-1-pentylindol-3-yl)furo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 139669632 |
| Molecular Formula | C35H43N3O3 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | 3-[2-butoxy-4-(diethylamino)phenyl]-3-(2-methyl-1-pentylindol-3-yl)furo[3,4-c]pyridin-1-one |
| SMILES | CCCCCn1c(C)c(C2(c3ccc(N(CC)CC)cc3OCCCC)OC(=O)c3ccncc32)c2ccccc21 |
| InChI | InChI=1S/C35H43N3O3/c1-6-10-14-21-38-25(5)33(28-15-12-13-16-31(28)38)35(30-24-36-20-19-27(30)34(39)41-35)29-18-17-26(37(8-3)9-4)23-32(29)40-22-11-7-2/h12-13,15-20,23-24H,6-11,14,21-22H2,1-5H3 |
| InChIKey | PKEILXCMAPTRCY-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|