C47H66N2O3 — CID 19856988
3-[4-(diethylamino)-2-ethoxyphenyl]-3-(2-methyl-1-octadecan-9-ylindol-3-yl)-2-benzofuran-1-one (PubChem CID 19856988) has the molecular formula C47H66N2O3 and a molecular weight of 707.06 g/mol. Its IUPAC name is 3-[4-(diethylamino)-2-ethoxyphenyl]-3-(2-methyl-1-octadecan-9-ylindol-3-yl)-2-benzofuran-1-one.
| Compound Name | 3-[4-(diethylamino)-2-ethoxyphenyl]-3-(2-methyl-1-octadecan-9-ylindol-3-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 19856988 |
| Molecular Formula | C47H66N2O3 |
| Molecular Weight | 707.06 g/mol |
| Exact Mass | 706.51 |
| IUPAC Name | 3-[4-(diethylamino)-2-ethoxyphenyl]-3-(2-methyl-1-octadecan-9-ylindol-3-yl)-2-benzofuran-1-one |
| SMILES | CCCCCCCCCC(CCCCCCCC)n1c(C)c(C2(c3ccc(N(CC)CC)cc3OCC)OC(=O)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C47H66N2O3/c1-7-12-14-16-18-20-22-28-37(27-21-19-17-15-13-8-2)49-36(6)45(40-30-24-26-32-43(40)49)47(41-31-25-23-29-39(41)46(50)52-47)42-34-33-38(48(9-3)10-4)35-44(42)51-11-5/h23-26,29-35,37H,7-22,27-28H2,1-6H3 |
| InChIKey | RTJJKGAMJUDMQK-UHFFFAOYSA-N |
| XLogP | 13.09 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.06 |
| LogP ≤ 5 | 13.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|