C37H47N3O3 — CID 18998081
7-[4-(diethylamino)-2-ethoxyphenyl]-7-(2-ethyl-1-octylindol-3-yl)furo[3,4-b]pyridin-5-one (PubChem CID 18998081) has the molecular formula C37H47N3O3 and a molecular weight of 581.80 g/mol. Its IUPAC name is 7-[4-(diethylamino)-2-ethoxyphenyl]-7-(2-ethyl-1-octylindol-3-yl)furo[3,4-b]pyridin-5-one.
| Compound Name | 7-[4-(diethylamino)-2-ethoxyphenyl]-7-(2-ethyl-1-octylindol-3-yl)furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 18998081 |
| Molecular Formula | C37H47N3O3 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.36 |
| IUPAC Name | 7-[4-(diethylamino)-2-ethoxyphenyl]-7-(2-ethyl-1-octylindol-3-yl)furo[3,4-b]pyridin-5-one |
| SMILES | CCCCCCCCn1c(CC)c(C2(c3ccc(N(CC)CC)cc3OCC)OC(=O)c3cccnc32)c2ccccc21 |
| InChI | InChI=1S/C37H47N3O3/c1-6-11-12-13-14-17-25-40-31(7-2)34(28-19-15-16-21-32(28)40)37(35-29(36(41)43-37)20-18-24-38-35)30-23-22-27(39(8-3)9-4)26-33(30)42-10-5/h15-16,18-24,26H,6-14,17,25H2,1-5H3 |
| InChIKey | KHMOBICTIZEBRC-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|