C36H37N3O3 — CID 139885391
7-[2-butoxy-4-(diethylamino)phenyl]-7-(1-methyl-2-phenylindol-3-yl)furo[3,4-b]pyridin-5-one (PubChem CID 139885391) has the molecular formula C36H37N3O3 and a molecular weight of 559.71 g/mol. Its IUPAC name is 7-[2-butoxy-4-(diethylamino)phenyl]-7-(1-methyl-2-phenylindol-3-yl)furo[3,4-b]pyridin-5-one.
| Compound Name | 7-[2-butoxy-4-(diethylamino)phenyl]-7-(1-methyl-2-phenylindol-3-yl)furo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139885391 |
| Molecular Formula | C36H37N3O3 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 7-[2-butoxy-4-(diethylamino)phenyl]-7-(1-methyl-2-phenylindol-3-yl)furo[3,4-b]pyridin-5-one |
| SMILES | CCCCOc1cc(N(CC)CC)ccc1C1(c2c(-c3ccccc3)n(C)c3ccccc23)OC(=O)c2cccnc21 |
| InChI | InChI=1S/C36H37N3O3/c1-5-8-23-41-31-24-26(39(6-2)7-3)20-21-29(31)36(34-28(35(40)42-36)18-14-22-37-34)32-27-17-12-13-19-30(27)38(4)33(32)25-15-10-9-11-16-25/h9-22,24H,5-8,23H2,1-4H3 |
| InChIKey | UAIXRWOHXMYLNB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|